C16H20O3S — CID 44580073
(3S,4R,5R)-5-(3-hydroxypropyl)-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one (PubChem CID 44580073) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is (3S,4R,5R)-5-(3-hydroxypropyl)-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-(3-hydroxypropyl)-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 44580073 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3S,4R,5R)-5-(3-hydroxypropyl)-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
| SMILES | C=CC[C@H]1[C@H](Sc2ccccc2)C(=O)O[C@@H]1CCCO |
| InChI | InChI=1S/C16H20O3S/c1-2-7-13-14(10-6-11-17)19-16(18)15(13)20-12-8-4-3-5-9-12/h2-5,8-9,13-15,17H,1,6-7,10-11H2/t13-,14-,15+/m1/s1 |
| InChIKey | CNCYSQJESGRMOK-KFWWJZLASA-N |
| XLogP | 3.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|