C17H20O2S — CID 44580075
(3S,4R,5R)-5-but-3-enyl-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one (PubChem CID 44580075) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is (3S,4R,5R)-5-but-3-enyl-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-but-3-enyl-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 44580075 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3S,4R,5R)-5-but-3-enyl-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
| SMILES | C=CCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CC=C |
| InChI | InChI=1S/C17H20O2S/c1-3-5-12-15-14(9-4-2)16(17(18)19-15)20-13-10-7-6-8-11-13/h3-4,6-8,10-11,14-16H,1-2,5,9,12H2/t14-,15-,16+/m1/s1 |
| InChIKey | UWWYEZLWEIKVQB-OAGGEKHMSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|