C27H34N2O3 — CID 44580081
(1R,4aS,10aR)-1,4a-dimethyl-6-(phenylcarbamoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 44580081) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-6-(phenylcarbamoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(phenylcarbamoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 44580081 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(phenylcarbamoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1NC(=O)Nc1ccccc1)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1CC2 |
| InChI | InChI=1S/C27H34N2O3/c1-17(2)20-15-18-11-12-23-26(3,13-8-14-27(23,4)24(30)31)21(18)16-22(20)29-25(32)28-19-9-6-5-7-10-19/h5-7,9-10,15-17,23H,8,11-14H2,1-4H3,(H,30,31)(H2,28,29,32)/t23-,26-,27-/m1/s1 |
| InChIKey | KUTAXMKGTDAMSJ-XSBVVTFOSA-N |
| XLogP | 6.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |