C17H16Cl2N4O — CID 44580095
3-(2,6-dichlorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole (PubChem CID 44580095) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole.
| Compound Name | 3-(2,6-dichlorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 44580095 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole |
| SMILES | Clc1cccc(Cl)c1-c1cc(-c2cnn(C3CCNCC3)c2)on1 |
| InChI | InChI=1S/C17H16Cl2N4O/c18-13-2-1-3-14(19)17(13)15-8-16(24-22-15)11-9-21-23(10-11)12-4-6-20-7-5-12/h1-3,8-10,12,20H,4-7H2 |
| InChIKey | CCDQOOKQQKTMOZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |