C15H16O2S — CID 44580111
(3S,3aR,8aR)-3-phenylsulfanyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 44580111) has the molecular formula C15H16O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is (3S,3aR,8aR)-3-phenylsulfanyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | (3S,3aR,8aR)-3-phenylsulfanyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 44580111 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (3S,3aR,8aR)-3-phenylsulfanyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | O=C1O[C@@H]2CCC=CC[C@H]2[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C15H16O2S/c16-15-14(18-11-7-3-1-4-8-11)12-9-5-2-6-10-13(12)17-15/h1-5,7-8,12-14H,6,9-10H2/t12-,13-,14+/m1/s1 |
| InChIKey | OLZXXMPTBVTVGO-MCIONIFRSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|