C17H30O5 — CID 44580177
(2S,3R,3aS,6aS)-2-(decoxymethyl)-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 44580177) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is (2S,3R,3aS,6aS)-2-(decoxymethyl)-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2S,3R,3aS,6aS)-2-(decoxymethyl)-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 44580177 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2S,3R,3aS,6aS)-2-(decoxymethyl)-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CCCCCCCCCCOC[C@@H]1O[C@H]2CC(=O)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C17H30O5/c1-2-3-4-5-6-7-8-9-10-20-12-14-16(19)17-13(21-14)11-15(18)22-17/h13-14,16-17,19H,2-12H2,1H3/t13-,14-,16+,17+/m0/s1 |
| InChIKey | FPIQEESDWALMJC-XJNFMUPTSA-N |
| XLogP | 2.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|