About (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine
(E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine (PubChem CID 44580180) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine.
Molecular Properties
| Compound Name | (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine |
| PubChem CID | 44580180 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine |
| SMILES | COc1cc(/C(=N/N)c2ccc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O3/c1-23-17-11-16(12-18(24-2)20(17)25-3)19(22-21)15-9-8-13-6-4-5-7-14(13)10-15/h4-12H,21H2,1-3H3/b22-19+ |
| InChIKey | FLKFWALCXYEQJB-ZBJSNUHESA-N |
| XLogP | 3.58 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine?
The IUPAC name of (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine (CID 44580180) is (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine.
What is the SMILES notation for (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine?
The canonical SMILES for (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine is COc1cc(/C(=N/N)c2ccc3ccccc3c2)cc(OC)c1OC.
What is the InChIKey of (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine?
The InChIKey is FLKFWALCXYEQJB-ZBJSNUHESA-N. The full InChI is InChI=1S/C20H20N2O3/c1-23-17-11-16(12-18(24-2)20(17)25-3)19(22-21)15-9-8-13-6-4-5-7-14(13)10-15/h4-12H,21H2,1-3H3/b22-19+.
What are the key properties of (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine?
(E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine has a molecular weight of 336.39 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-[naphthalen-2-yl-(3,4,5-trimethoxyphenyl)methylidene]hydrazine is sourced from PubChem (CID 44580180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).