C17H20O4S — CID 44580245
(3R,3aS,7aS)-7a-(benzenesulfonyl)-3-propyl-3,3a,4,7-tetrahydro-2-benzofuran-1-one (PubChem CID 44580245) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is (3R,3aS,7aS)-7a-(benzenesulfonyl)-3-propyl-3,3a,4,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aS,7aS)-7a-(benzenesulfonyl)-3-propyl-3,3a,4,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 44580245 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (3R,3aS,7aS)-7a-(benzenesulfonyl)-3-propyl-3,3a,4,7-tetrahydro-2-benzofuran-1-one |
| SMILES | CCC[C@H]1OC(=O)[C@]2(S(=O)(=O)c3ccccc3)CC=CC[C@@H]12 |
| InChI | InChI=1S/C17H20O4S/c1-2-8-15-14-11-6-7-12-17(14,16(18)21-15)22(19,20)13-9-4-3-5-10-13/h3-7,9-10,14-15H,2,8,11-12H2,1H3/t14-,15+,17-/m0/s1 |
| InChIKey | XBGJCIGBUPCGDX-UXLLHSPISA-N |
| XLogP | 2.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|