About N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide
N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide (PubChem CID 44580251) has the molecular formula C17H20ClN3O2
and a molecular weight of 333.82 g/mol. Its IUPAC name is N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide |
| PubChem CID | 44580251 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CN(Cc1cc(-c2ccccc2Cl)no1)C(=O)C1CCNCC1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-21(17(22)12-6-8-19-9-7-12)11-13-10-16(20-23-13)14-4-2-3-5-15(14)18/h2-5,10,12,19H,6-9,11H2,1H3 |
| InChIKey | CYVLVDMCSIBANZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide?
The IUPAC name of N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide (CID 44580251) is N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide.
What is the SMILES notation for N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide?
The canonical SMILES for N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide is CN(Cc1cc(-c2ccccc2Cl)no1)C(=O)C1CCNCC1.
What is the InChIKey of N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide?
The InChIKey is CYVLVDMCSIBANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O2/c1-21(17(22)12-6-8-19-9-7-12)11-13-10-16(20-23-13)14-4-2-3-5-15(14)18/h2-5,10,12,19H,6-9,11H2,1H3.
What are the key properties of N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide?
N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide has a molecular weight of 333.82 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-N-methylpiperidine-4-carboxamide is sourced from PubChem (CID 44580251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).