C18H22O4S — CID 44580279
(3R,3aR,8aS)-8a-(benzenesulfonyl)-3-propyl-3a,4,7,8-tetrahydro-3H-cyclohepta[c]furan-1-one (PubChem CID 44580279) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is (3R,3aR,8aS)-8a-(benzenesulfonyl)-3-propyl-3a,4,7,8-tetrahydro-3H-cyclohepta[c]furan-1-one.
| Compound Name | (3R,3aR,8aS)-8a-(benzenesulfonyl)-3-propyl-3a,4,7,8-tetrahydro-3H-cyclohepta[c]furan-1-one |
|---|---|
| PubChem CID | 44580279 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (3R,3aR,8aS)-8a-(benzenesulfonyl)-3-propyl-3a,4,7,8-tetrahydro-3H-cyclohepta[c]furan-1-one |
| SMILES | CCC[C@H]1OC(=O)[C@]2(S(=O)(=O)c3ccccc3)CCC=CC[C@H]12 |
| InChI | InChI=1S/C18H22O4S/c1-2-9-16-15-12-7-4-8-13-18(15,17(19)22-16)23(20,21)14-10-5-3-6-11-14/h3-7,10-11,15-16H,2,8-9,12-13H2,1H3/t15-,16-,18+/m1/s1 |
| InChIKey | SBVWYLPPJJGTFE-NUJGCVRESA-N |
| XLogP | 3.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|