C23H34O5S — CID 44580280
(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-5-propyloxolan-2-one (PubChem CID 44580280) has the molecular formula C23H34O5S and a molecular weight of 422.59 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 44580280 |
| Molecular Formula | C23H34O5S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-5-propyloxolan-2-one |
| SMILES | C=CCCCCCCOCC[C@H]1[C@H](S(=O)(=O)c2ccccc2)C(=O)O[C@@H]1CCC |
| InChI | InChI=1S/C23H34O5S/c1-3-5-6-7-8-12-17-27-18-16-20-21(13-4-2)28-23(24)22(20)29(25,26)19-14-10-9-11-15-19/h3,9-11,14-15,20-22H,1,4-8,12-13,16-18H2,2H3/t20-,21-,22+/m1/s1 |
| InChIKey | OYUSNZDXRZIQFQ-VSKRKVRLSA-N |
| XLogP | 4.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|