C26H38O5S — CID 44580281
(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one (PubChem CID 44580281) has the molecular formula C26H38O5S and a molecular weight of 462.65 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 44580281 |
| Molecular Formula | C26H38O5S |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-oct-7-enoxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one |
| SMILES | C=CCCCCCCOCC[C@@H]1[C@@H](CCC)OC(=O)[C@@]1(CC=C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H38O5S/c1-4-7-8-9-10-14-20-30-21-18-23-24(15-5-2)31-25(27)26(23,19-6-3)32(28,29)22-16-12-11-13-17-22/h4,6,11-13,16-17,23-24H,1,3,5,7-10,14-15,18-21H2,2H3/t23-,24-,26+/m1/s1 |
| InChIKey | KLODKUSIBHNMJN-MZKUHISZSA-N |
| XLogP | 5.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|