C24H34O5S — CID 44580282
(1R,11Z,14S,17R)-14-(benzenesulfonyl)-17-propyl-4,16-dioxabicyclo[12.3.0]heptadec-11-en-15-one (PubChem CID 44580282) has the molecular formula C24H34O5S and a molecular weight of 434.60 g/mol. Its IUPAC name is (1R,11Z,14S,17R)-14-(benzenesulfonyl)-17-propyl-4,16-dioxabicyclo[12.3.0]heptadec-11-en-15-one.
| Compound Name | (1R,11Z,14S,17R)-14-(benzenesulfonyl)-17-propyl-4,16-dioxabicyclo[12.3.0]heptadec-11-en-15-one |
|---|---|
| PubChem CID | 44580282 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (1R,11Z,14S,17R)-14-(benzenesulfonyl)-17-propyl-4,16-dioxabicyclo[12.3.0]heptadec-11-en-15-one |
| SMILES | CCC[C@H]1OC(=O)[C@]2(S(=O)(=O)c3ccccc3)C/C=C\CCCCCCOCC[C@H]12 |
| InChI | InChI=1S/C24H34O5S/c1-2-13-22-21-16-19-28-18-12-7-5-3-4-6-11-17-24(21,23(25)29-22)30(26,27)20-14-9-8-10-15-20/h6,8-11,14-15,21-22H,2-5,7,12-13,16-19H2,1H3/b11-6-/t21-,22-,24+/m1/s1 |
| InChIKey | GODWUQFSMDOQGQ-WGYZNAEPSA-N |
| XLogP | 4.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|