C18H20N4O — CID 44580285
5-(5-methyl-1-piperidin-4-ylpyrazol-4-yl)-3-phenyl-1,2-oxazole (PubChem CID 44580285) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-(5-methyl-1-piperidin-4-ylpyrazol-4-yl)-3-phenyl-1,2-oxazole.
| Compound Name | 5-(5-methyl-1-piperidin-4-ylpyrazol-4-yl)-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 44580285 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 5-(5-methyl-1-piperidin-4-ylpyrazol-4-yl)-3-phenyl-1,2-oxazole |
| SMILES | Cc1c(-c2cc(-c3ccccc3)no2)cnn1C1CCNCC1 |
| InChI | InChI=1S/C18H20N4O/c1-13-16(12-20-22(13)15-7-9-19-10-8-15)18-11-17(21-23-18)14-5-3-2-4-6-14/h2-6,11-12,15,19H,7-10H2,1H3 |
| InChIKey | XOFIFFNLXAVCSI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |