About (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine
(4-methoxy-9,10-dihydroanthracen-9-yl)methanamine (PubChem CID 44580318) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine.
Molecular Properties
| Compound Name | (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine |
| PubChem CID | 44580318 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine |
| SMILES | COc1cccc2c1Cc1ccccc1C2CN |
| InChI | InChI=1S/C16H17NO/c1-18-16-8-4-7-13-14(16)9-11-5-2-3-6-12(11)15(13)10-17/h2-8,15H,9-10,17H2,1H3 |
| InChIKey | ZJILWLYMMRQWLR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine?
The IUPAC name of (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine (CID 44580318) is (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine.
What is the SMILES notation for (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine?
The canonical SMILES for (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine is COc1cccc2c1Cc1ccccc1C2CN.
What is the InChIKey of (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine?
The InChIKey is ZJILWLYMMRQWLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-18-16-8-4-7-13-14(16)9-11-5-2-3-6-12(11)15(13)10-17/h2-8,15H,9-10,17H2,1H3.
What are the key properties of (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine?
(4-methoxy-9,10-dihydroanthracen-9-yl)methanamine has a molecular weight of 239.32 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-9,10-dihydroanthracen-9-yl)methanamine is sourced from PubChem (CID 44580318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).