C27H30FN5O — CID 44580339
5-fluoro-1-[4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-2-pyridin-2-ylbenzimidazole (PubChem CID 44580339) has the molecular formula C27H30FN5O and a molecular weight of 459.57 g/mol. Its IUPAC name is 5-fluoro-1-[4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-2-pyridin-2-ylbenzimidazole.
| Compound Name | 5-fluoro-1-[4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-2-pyridin-2-ylbenzimidazole |
|---|---|
| PubChem CID | 44580339 |
| Molecular Formula | C27H30FN5O |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 5-fluoro-1-[4-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]phenyl]-2-pyridin-2-ylbenzimidazole |
| SMILES | CN1CCCN(CCCOc2ccc(-n3c(-c4ccccn4)nc4cc(F)ccc43)cc2)CC1 |
| InChI | InChI=1S/C27H30FN5O/c1-31-14-4-15-32(18-17-31)16-5-19-34-23-10-8-22(9-11-23)33-26-12-7-21(28)20-25(26)30-27(33)24-6-2-3-13-29-24/h2-3,6-13,20H,4-5,14-19H2,1H3 |
| InChIKey | BFUXPMGBMKKASW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|