C24H35NO3 — CID 44580654
(1R,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 44580654) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 44580654 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC(C)C(=O)Nc1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C24H35NO3/c1-14(2)17-12-16-8-9-20-23(5,10-7-11-24(20,6)22(27)28)18(16)13-19(17)25-21(26)15(3)4/h12-15,20H,7-11H2,1-6H3,(H,25,26)(H,27,28)/t20-,23-,24-/m1/s1 |
| InChIKey | LLCQFSFZUVGOHN-AGILITTLSA-N |
| XLogP | 5.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |