C24H28N2+2 — CID 44580662
1,6-diazoniatricyclo[19.3.1.16,10]hexacosa-1(24),6,8,10(26),21(25),22-hexaen-11,19-diyne (PubChem CID 44580662) has the molecular formula C24H28N2+2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1,6-diazoniatricyclo[19.3.1.16,10]hexacosa-1(24),6,8,10(26),21(25),22-hexaen-11,19-diyne.
| Compound Name | 1,6-diazoniatricyclo[19.3.1.16,10]hexacosa-1(24),6,8,10(26),21(25),22-hexaen-11,19-diyne |
|---|---|
| PubChem CID | 44580662 |
| Molecular Formula | C24H28N2+2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1,6-diazoniatricyclo[19.3.1.16,10]hexacosa-1(24),6,8,10(26),21(25),22-hexaen-11,19-diyne |
| SMILES | C1#Cc2ccc[n+](c2)CCCC[n+]2cccc(c2)C#CCCCCCC1 |
| InChI | InChI=1S/C24H28N2/c1-2-4-6-8-14-24-16-12-20-26(22-24)18-10-9-17-25-19-11-15-23(21-25)13-7-5-3-1/h11-12,15-16,19-22H,1-6,9-10,17-18H2/q+2 |
| InChIKey | DNGBQOCOKXCDOY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|