C27H39NO3 — CID 44580693
(1R,4aS,10aR)-6-(cyclohexanecarbonylamino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 44580693) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is (1R,4aS,10aR)-6-(cyclohexanecarbonylamino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-6-(cyclohexanecarbonylamino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 44580693 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (1R,4aS,10aR)-6-(cyclohexanecarbonylamino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1NC(=O)C1CCCCC1)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1CC2 |
| InChI | InChI=1S/C27H39NO3/c1-17(2)20-15-19-11-12-23-26(3,13-8-14-27(23,4)25(30)31)21(19)16-22(20)28-24(29)18-9-6-5-7-10-18/h15-18,23H,5-14H2,1-4H3,(H,28,29)(H,30,31)/t23-,26-,27-/m1/s1 |
| InChIKey | LEVPEWWLBJSIEV-XSBVVTFOSA-N |
| XLogP | 6.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |