C30H34O5SSi — CID 44580726
2-[(2R,3R,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid (PubChem CID 44580726) has the molecular formula C30H34O5SSi and a molecular weight of 534.75 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 44580726 |
| Molecular Formula | C30H34O5SSi |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-[(2R,3R,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](OCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34O5SSi/c1-30(2,3)37(23-15-9-5-10-16-23,24-17-11-6-12-18-24)34-20-19-26-25(21-27(31)32)28(29(33)35-26)36-22-13-7-4-8-14-22/h4-18,25-26,28H,19-21H2,1-3H3,(H,31,32)/t25-,26-,28+/m1/s1 |
| InChIKey | ZAEFJARNSOFTFQ-GTNKKZTPSA-N |
| XLogP | 5.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|