C31H36O5SSi — CID 44580727
2-[(2R,3R,4S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid (PubChem CID 44580727) has the molecular formula C31H36O5SSi and a molecular weight of 548.78 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 44580727 |
| Molecular Formula | C31H36O5SSi |
| Molecular Weight | 548.78 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-[(2R,3R,4S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-oxo-4-phenylsulfanyloxolan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](OCCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36O5SSi/c1-31(2,3)38(24-16-9-5-10-17-24,25-18-11-6-12-19-25)35-21-13-20-27-26(22-28(32)33)29(30(34)36-27)37-23-14-7-4-8-15-23/h4-12,14-19,26-27,29H,13,20-22H2,1-3H3,(H,32,33)/t26-,27-,29+/m1/s1 |
| InChIKey | DYQOWRWSKMIAEL-QQJNOOCOSA-N |
| XLogP | 5.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.78 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|