C15H18O4S — CID 44580728
2-[(2R,3R,4S)-5-oxo-4-phenylsulfanyl-2-propyloxolan-3-yl]acetic acid (PubChem CID 44580728) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-5-oxo-4-phenylsulfanyl-2-propyloxolan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S)-5-oxo-4-phenylsulfanyl-2-propyloxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 44580728 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[(2R,3R,4S)-5-oxo-4-phenylsulfanyl-2-propyloxolan-3-yl]acetic acid |
| SMILES | CCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C15H18O4S/c1-2-6-12-11(9-13(16)17)14(15(18)19-12)20-10-7-4-3-5-8-10/h3-5,7-8,11-12,14H,2,6,9H2,1H3,(H,16,17)/t11-,12-,14+/m1/s1 |
| InChIKey | YEEDVGAXWQCIRV-BZPMIXESSA-N |
| XLogP | 2.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |