About (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate
(5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate (PubChem CID 44580736) has the molecular formula C16H11ClN2O3
and a molecular weight of 314.73 g/mol. Its IUPAC name is (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate.
Molecular Properties
| Compound Name | (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate |
| PubChem CID | 44580736 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate |
| SMILES | CC(=O)n1ccc2cc(C(=O)Oc3cncc(Cl)c3)ccc21 |
| InChI | InChI=1S/C16H11ClN2O3/c1-10(20)19-5-4-11-6-12(2-3-15(11)19)16(21)22-14-7-13(17)8-18-9-14/h2-9H,1H3 |
| InChIKey | OCDAGQUKTMTFLK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate?
The IUPAC name of (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate (CID 44580736) is (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate.
What is the SMILES notation for (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate?
The canonical SMILES for (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate is CC(=O)n1ccc2cc(C(=O)Oc3cncc(Cl)c3)ccc21.
What is the InChIKey of (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate?
The InChIKey is OCDAGQUKTMTFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O3/c1-10(20)19-5-4-11-6-12(2-3-15(11)19)16(21)22-14-7-13(17)8-18-9-14/h2-9H,1H3.
What are the key properties of (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate?
(5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate has a molecular weight of 314.73 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-3-pyridinyl) 1-acetylindole-5-carboxylate is sourced from PubChem (CID 44580736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).