About 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine
4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine (PubChem CID 44580758) has the molecular formula C21H15N5O2S
and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine |
| PubChem CID | 44580758 |
| Molecular Formula | C21H15N5O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine |
| SMILES | COc1cccc(-c2ccc(Oc3cncc4sc(-c5nn[nH]n5)cc34)cc2)c1 |
| InChI | InChI=1S/C21H15N5O2S/c1-27-16-4-2-3-14(9-16)13-5-7-15(8-6-13)28-18-11-22-12-20-17(18)10-19(29-20)21-23-25-26-24-21/h2-12H,1H3,(H,23,24,25,26) |
| InChIKey | UBNBGXVNHMNBMY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine?
The IUPAC name of 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine (CID 44580758) is 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine.
What is the SMILES notation for 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine?
The canonical SMILES for 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine is COc1cccc(-c2ccc(Oc3cncc4sc(-c5nn[nH]n5)cc34)cc2)c1.
What is the InChIKey of 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine?
The InChIKey is UBNBGXVNHMNBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N5O2S/c1-27-16-4-2-3-14(9-16)13-5-7-15(8-6-13)28-18-11-22-12-20-17(18)10-19(29-20)21-23-25-26-24-21/h2-12H,1H3,(H,23,24,25,26).
What are the key properties of 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine?
4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine has a molecular weight of 401.45 g/mol, XLogP of 4.94, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-methoxyphenyl)phenoxy]-2-(2H-tetrazol-5-yl)thieno[2,3-c]pyridine is sourced from PubChem (CID 44580758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).