C15H20O3S — CID 44580774
(3S,4R,5R)-4-(2-hydroxyethyl)-3-phenylsulfanyl-5-propyloxolan-2-one (PubChem CID 44580774) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (3S,4R,5R)-4-(2-hydroxyethyl)-3-phenylsulfanyl-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-4-(2-hydroxyethyl)-3-phenylsulfanyl-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 44580774 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3S,4R,5R)-4-(2-hydroxyethyl)-3-phenylsulfanyl-5-propyloxolan-2-one |
| SMILES | CCC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1CCO |
| InChI | InChI=1S/C15H20O3S/c1-2-6-13-12(9-10-16)14(15(17)18-13)19-11-7-4-3-5-8-11/h3-5,7-8,12-14,16H,2,6,9-10H2,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | DRBXULBAIXTMCP-MCIONIFRSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |