C31H36O3SSi — CID 44580775
(3S,4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one (PubChem CID 44580775) has the molecular formula C31H36O3SSi and a molecular weight of 516.78 g/mol. Its IUPAC name is (3S,4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 44580775 |
| Molecular Formula | C31H36O3SSi |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | (3S,4R,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-phenylsulfanyl-4-prop-2-enyloxolan-2-one |
| SMILES | C=CC[C@H]1[C@H](Sc2ccccc2)C(=O)O[C@@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H36O3SSi/c1-5-15-27-28(34-30(32)29(27)35-24-16-9-6-10-17-24)22-23-33-36(31(2,3)4,25-18-11-7-12-19-25)26-20-13-8-14-21-26/h5-14,16-21,27-29H,1,15,22-23H2,2-4H3/t27-,28-,29+/m1/s1 |
| InChIKey | JGWKUHYHVJCCGU-NLDZOOGBSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|