C34H36N4O4 — CID 44580806
cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]-1-N-(piperidin-4-ylmethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 44580806) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]-1-N-(piperidin-4-ylmethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]-1-N-(piperidin-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 44580806 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]-1-N-(piperidin-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NO)[C@H]1C[C@]1(Cc1ccc(OCc2cc(-c3ccccc3)nc3ccccc23)cc1)C(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C34H36N4O4/c39-32(38-41)29-20-34(29,33(40)36-21-24-14-16-35-17-15-24)19-23-10-12-27(13-11-23)42-22-26-18-31(25-6-2-1-3-7-25)37-30-9-5-4-8-28(26)30/h1-13,18,24,29,35,41H,14-17,19-22H2,(H,36,40)(H,38,39)/t29-,34+/m1/s1 |
| InChIKey | LZHATKQUQHRBAF-SJHOIFEDSA-N |
| XLogP | 4.65 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|