About (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one
(2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one (PubChem CID 44580816) has the molecular formula C13H12ClN3OS2
and a molecular weight of 325.85 g/mol. Its IUPAC name is (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one |
| PubChem CID | 44580816 |
| Molecular Formula | C13H12ClN3OS2 |
| Molecular Weight | 325.85 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(C)S/C1=N\c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C13H12ClN3OS2/c1-3-17-11(18)7(2)19-13(17)16-12-15-10-8(14)5-4-6-9(10)20-12/h4-7H,3H2,1-2H3/b16-13- |
| InChIKey | GCXOFMNUOVTDNQ-SSZFMOIBSA-N |
| XLogP | 3.92 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one?
The IUPAC name of (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one (CID 44580816) is (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one.
What is the SMILES notation for (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one?
The canonical SMILES for (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one is CCN1C(=O)C(C)S/C1=N\c1nc2c(Cl)cccc2s1.
What is the InChIKey of (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one?
The InChIKey is GCXOFMNUOVTDNQ-SSZFMOIBSA-N. The full InChI is InChI=1S/C13H12ClN3OS2/c1-3-17-11(18)7(2)19-13(17)16-12-15-10-8(14)5-4-6-9(10)20-12/h4-7H,3H2,1-2H3/b16-13-.
What are the key properties of (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one?
(2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one has a molecular weight of 325.85 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(4-chloro-1,3-benzothiazol-2-yl)imino]-3-ethyl-5-methyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 44580816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).