C30H48N4O6 — CID 44580833
tert-butyl N-[(2S)-1-[(1S,2S,5R)-2-[[(3S)-1-amino-1,2-dioxonon-8-en-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxooct-7-en-2-yl]carbamate (PubChem CID 44580833) has the molecular formula C30H48N4O6 and a molecular weight of 560.74 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(1S,2S,5R)-2-[[(3S)-1-amino-1,2-dioxonon-8-en-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxooct-7-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(1S,2S,5R)-2-[[(3S)-1-amino-1,2-dioxonon-8-en-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxooct-7-en-2-yl]carbamate |
|---|---|
| PubChem CID | 44580833 |
| Molecular Formula | C30H48N4O6 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(1S,2S,5R)-2-[[(3S)-1-amino-1,2-dioxonon-8-en-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxooct-7-en-2-yl]carbamate |
| SMILES | C=CCCCC[C@H](NC(=O)[C@@H]1[C@H]2[C@@H](CN1C(=O)[C@H](CCCCC=C)NC(=O)OC(C)(C)C)C2(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C30H48N4O6/c1-8-10-12-14-16-20(24(35)25(31)36)32-26(37)23-22-19(30(22,6)7)18-34(23)27(38)21(17-15-13-11-9-2)33-28(39)40-29(3,4)5/h8-9,19-23H,1-2,10-18H2,3-7H3,(H2,31,36)(H,32,37)(H,33,39)/t19-,20+,21+,22-,23+/m1/s1 |
| InChIKey | OFBFPNVYRBBLFL-YSFPZDHXSA-N |
| XLogP | 3.39 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|