About 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine
4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine (PubChem CID 44580869) has the molecular formula C20H22N2O
and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine |
| PubChem CID | 44580869 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine |
| SMILES | COc1ccc(N(C)c2ccc(N(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N2O/c1-21(2)19-13-14-20(18-8-6-5-7-17(18)19)22(3)15-9-11-16(23-4)12-10-15/h5-14H,1-4H3 |
| InChIKey | MODMZBWRMXSAGI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine?
The IUPAC name of 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine (CID 44580869) is 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine.
What is the SMILES notation for 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine?
The canonical SMILES for 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine is COc1ccc(N(C)c2ccc(N(C)C)c3ccccc23)cc1.
What is the InChIKey of 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine?
The InChIKey is MODMZBWRMXSAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O/c1-21(2)19-13-14-20(18-8-6-5-7-17(18)19)22(3)15-9-11-16(23-4)12-10-15/h5-14H,1-4H3.
What are the key properties of 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine?
4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine has a molecular weight of 306.41 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-methoxyphenyl)-1-N,1-N,4-N-trimethylnaphthalene-1,4-diamine is sourced from PubChem (CID 44580869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).