C29H42O7 — CID 44580944
(1R,10S,12S,14E,16S,19R,20R,21S,22R)-6,8,21-trihydroxy-5,10,12,14,16,20,22-heptamethyl-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione (PubChem CID 44580944) has the molecular formula C29H42O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is (1R,10S,12S,14E,16S,19R,20R,21S,22R)-6,8,21-trihydroxy-5,10,12,14,16,20,22-heptamethyl-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione.
| Compound Name | (1R,10S,12S,14E,16S,19R,20R,21S,22R)-6,8,21-trihydroxy-5,10,12,14,16,20,22-heptamethyl-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione |
|---|---|
| PubChem CID | 44580944 |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (1R,10S,12S,14E,16S,19R,20R,21S,22R)-6,8,21-trihydroxy-5,10,12,14,16,20,22-heptamethyl-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione |
| SMILES | CC1=C(O)C2=C(C(=O)C1=O)[C@@H]1O[C@H](CC[C@H](C)/C=C(\C)C[C@@H](C)C[C@H](C)C(=O)C2O)[C@H](C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C29H42O7/c1-13-8-9-20-17(5)24(31)19(7)29(36-20)22-21(25(32)18(6)26(33)28(22)35)27(34)23(30)16(4)12-15(3)11-14(2)10-13/h10,13,15-17,19-20,24,27,29,31-32,34H,8-9,11-12H2,1-7H3/b14-10+/t13-,15+,16-,17-,19+,20+,24-,27?,29+/m0/s1 |
| InChIKey | XAUGKRCLURPCNV-RSBYCFOASA-N |
| XLogP | 4.03 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|