C18H17ClN2O3 — CID 44581101
(5E)-1-benzyl-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;hydrochloride (PubChem CID 44581101) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is (5E)-1-benzyl-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | (5E)-1-benzyl-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 44581101 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (5E)-1-benzyl-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;hydrochloride |
| SMILES | COc1ccc(/C=C2\C(=O)NC(=O)N2Cc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H16N2O3.ClH/c1-23-15-9-7-13(8-10-15)11-16-17(21)19-18(22)20(16)12-14-5-3-2-4-6-14;/h2-11H,12H2,1H3,(H,19,21,22);1H/b16-11+; |
| InChIKey | RCBHLJWUQUHZRQ-YFMOEUEHSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|