C26H24FN5O4 — CID 44581163
cis-(1R,2S)-1-[[3-fluoro-4-[[2-(1-methylpyrazol-3-yl)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide (PubChem CID 44581163) has the molecular formula C26H24FN5O4 and a molecular weight of 489.51 g/mol. Its IUPAC name is cis-(1R,2S)-1-[[3-fluoro-4-[[2-(1-methylpyrazol-3-yl)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-1-[[3-fluoro-4-[[2-(1-methylpyrazol-3-yl)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 44581163 |
| Molecular Formula | C26H24FN5O4 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | cis-(1R,2S)-1-[[3-fluoro-4-[[2-(1-methylpyrazol-3-yl)quinolin-4-yl]methoxy]phenyl]methyl]-2-N-hydroxycyclopropane-1,2-dicarboxamide |
| SMILES | Cn1ccc(-c2cc(COc3ccc(C[C@]4(C(N)=O)C[C@@H]4C(=O)NO)cc3F)c3ccccc3n2)n1 |
| InChI | InChI=1S/C26H24FN5O4/c1-32-9-8-21(30-32)22-11-16(17-4-2-3-5-20(17)29-22)14-36-23-7-6-15(10-19(23)27)12-26(25(28)34)13-18(26)24(33)31-35/h2-11,18,35H,12-14H2,1H3,(H2,28,34)(H,31,33)/t18-,26+/m1/s1 |
| InChIKey | RWXQTLWYBFBYNB-DWXRJYCRSA-N |
| XLogP | 2.89 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|