C38H36N6O4 — CID 44581205
N-[1-(4-ethylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetamide (PubChem CID 44581205) has the molecular formula C38H36N6O4 and a molecular weight of 640.74 g/mol. Its IUPAC name is N-[1-(4-ethylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetamide.
| Compound Name | N-[1-(4-ethylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetamide |
|---|---|
| PubChem CID | 44581205 |
| Molecular Formula | C38H36N6O4 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | N-[1-(4-ethylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetamide |
| SMILES | CCN1CCN(C(=O)C(Cc2ccccc2)NC(=O)Cn2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)C(=O)N(C)C4=O)CC1 |
| InChI | InChI=1S/C38H36N6O4/c1-3-42-17-19-43(20-18-42)36(46)27(21-23-11-5-4-6-12-23)39-29(45)22-44-28-16-10-8-14-25(28)31-33-32(37(47)41(2)38(33)48)30-24-13-7-9-15-26(24)40-34(30)35(31)44/h4-16,27,40H,3,17-22H2,1-2H3,(H,39,45) |
| InChIKey | YWFWJRSLGATFCD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|