About (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide
(3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide (PubChem CID 44581360) has the molecular formula C22H24N2O6
and a molecular weight of 412.44 g/mol. Its IUPAC name is (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide.
Molecular Properties
| Compound Name | (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide |
| PubChem CID | 44581360 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide |
| SMILES | COc1ccc(OC)c(C(=O)CCC(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)c1 |
| InChI | InChI=1S/C22H24N2O6/c1-29-15-8-10-19(30-2)16(13-15)18(25)9-11-20(26)24-17(21(27)22(23)28)12-14-6-4-3-5-7-14/h3-8,10,13,17H,9,11-12H2,1-2H3,(H2,23,28)(H,24,26)/t17-/m0/s1 |
| InChIKey | LFVRPJOMCAYKBG-KRWDZBQOSA-N |
| XLogP | 1.45 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide?
The IUPAC name of (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide (CID 44581360) is (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide.
What is the SMILES notation for (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide?
The canonical SMILES for (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide is COc1ccc(OC)c(C(=O)CCC(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)c1.
What is the InChIKey of (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide?
The InChIKey is LFVRPJOMCAYKBG-KRWDZBQOSA-N. The full InChI is InChI=1S/C22H24N2O6/c1-29-15-8-10-19(30-2)16(13-15)18(25)9-11-20(26)24-17(21(27)22(23)28)12-14-6-4-3-5-7-14/h3-8,10,13,17H,9,11-12H2,1-2H3,(H2,23,28)(H,24,26)/t17-/m0/s1.
What are the key properties of (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide?
(3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide has a molecular weight of 412.44 g/mol, XLogP of 1.45, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]amino]-2-oxo-4-phenylbutanamide is sourced from PubChem (CID 44581360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).