C27H32N4O5 — CID 44581477
2-[(4R)-4-[[(2S)-2-(dimethylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]acetic acid (PubChem CID 44581477) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-[(4R)-4-[[(2S)-2-(dimethylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]acetic acid.
| Compound Name | 2-[(4R)-4-[[(2S)-2-(dimethylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]acetic acid |
|---|---|
| PubChem CID | 44581477 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 2-[(4R)-4-[[(2S)-2-(dimethylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]acetic acid |
| SMILES | Cc1cc(O)cc(C)c1C[C@@H](C(=O)N[C@@H]1Cc2c([nH]c3ccccc23)CN(CC(=O)O)C1=O)N(C)C |
| InChI | InChI=1S/C27H32N4O5/c1-15-9-17(32)10-16(2)19(15)12-24(30(3)4)26(35)29-22-11-20-18-7-5-6-8-21(18)28-23(20)13-31(27(22)36)14-25(33)34/h5-10,22,24,28,32H,11-14H2,1-4H3,(H,29,35)(H,33,34)/t22-,24+/m1/s1 |
| InChIKey | XTEHMRJXZGIECL-VWNXMTODSA-N |
| XLogP | 2.12 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|