C15H22N2O3S2 — CID 44581489
(2R)-3-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 44581489) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (2R)-3-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44581489 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R)-3-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | C[C@H](S)C(=O)N[C@@H](CSCc1ccc(N(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O3S2/c1-10(21)14(18)16-13(15(19)20)9-22-8-11-4-6-12(7-5-11)17(2)3/h4-7,10,13,21H,8-9H2,1-3H3,(H,16,18)(H,19,20)/t10-,13-/m0/s1 |
| InChIKey | DUGBMGNBJJXSSI-GWCFXTLKSA-N |
| XLogP | 1.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|