C40H54O6 — CID 44581548
(1R)-6-(4-butylphenoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-6-(4-butylphenoxy)-1-hydroxyhex-3-ynyl]oxolan-2-yl]oxolan-2-yl]hex-3-yn-1-ol (PubChem CID 44581548) has the molecular formula C40H54O6 and a molecular weight of 630.90 g/mol. Its IUPAC name is (1R)-6-(4-butylphenoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-6-(4-butylphenoxy)-1-hydroxyhex-3-ynyl]oxolan-2-yl]oxolan-2-yl]hex-3-yn-1-ol.
| Compound Name | (1R)-6-(4-butylphenoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-6-(4-butylphenoxy)-1-hydroxyhex-3-ynyl]oxolan-2-yl]oxolan-2-yl]hex-3-yn-1-ol |
|---|---|
| PubChem CID | 44581548 |
| Molecular Formula | C40H54O6 |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | (1R)-6-(4-butylphenoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-6-(4-butylphenoxy)-1-hydroxyhex-3-ynyl]oxolan-2-yl]oxolan-2-yl]hex-3-yn-1-ol |
| SMILES | CCCCC1=CC=C(C=C1)OCCC#CC[C@H]([C@H]2CC[C@@H](O2)[C@H]3CC[C@@H](O3)[C@@H](CC#CCCOC4=CC=C(C=C4)CCCC)O)O |
| InChI | InChI=1S/C40H54O6/c1-3-5-13-31-17-21-33(22-18-31)43-29-11-7-9-15-35(41)37-25-27-39(45-37)40-28-26-38(46-40)36(42)16-10-8-12-30-44-34-23-19-32(20-24-34)14-6-4-2/h17-24,35-42H,3-6,11-16,25-30H2,1-2H3/t35-,36-,37-,38-,39-,40-/m1/s1 |
| InChIKey | MDEULAGRCKIUHD-ZNAXKYJTSA-N |
| XLogP | 9.00 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | 877 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|