C14H18ClNO3S2 — CID 44581552
(2R)-3-[(4-chlorophenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 44581552) has the molecular formula C14H18ClNO3S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is (2R)-3-[(4-chlorophenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-[(4-chlorophenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44581552 |
| Molecular Formula | C14H18ClNO3S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (2R)-3-[(4-chlorophenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | C[C@H](CS)C(=O)N[C@@H](CSCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C14H18ClNO3S2/c1-9(6-20)13(17)16-12(14(18)19)8-21-7-10-2-4-11(15)5-3-10/h2-5,9,12,20H,6-8H2,1H3,(H,16,17)(H,18,19)/t9-,12+/m1/s1 |
| InChIKey | JAZLBAMIOMLJKI-SKDRFNHKSA-N |
| XLogP | 2.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|