C29H26N4O5 — CID 44581755
4-methyl-2-[[2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetyl]amino]pentanoic acid (PubChem CID 44581755) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is 4-methyl-2-[[2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 44581755 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 4-methyl-2-[[2-(13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)Cn1c2ccccc2c2c3c(c4c5ccccc5[nH]c4c21)C(=O)N(C)C3=O)C(=O)O |
| InChI | InChI=1S/C29H26N4O5/c1-14(2)12-18(29(37)38)30-20(34)13-33-19-11-7-5-9-16(19)22-24-23(27(35)32(3)28(24)36)21-15-8-4-6-10-17(15)31-25(21)26(22)33/h4-11,14,18,31H,12-13H2,1-3H3,(H,30,34)(H,37,38) |
| InChIKey | HXWAYWCIKBWVCS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|