About 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline
8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline (PubChem CID 44581758) has the molecular formula C22H23F3N4O2
and a molecular weight of 432.45 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline.
Molecular Properties
| Compound Name | 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline |
| PubChem CID | 44581758 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)cc3ncc(N4CCN(C)CC4)nc23)cc1OC |
| InChI | InChI=1S/C22H23F3N4O2/c1-28-6-8-29(9-7-28)20-13-26-17-12-15(22(23,24)25)11-16(21(17)27-20)14-4-5-18(30-2)19(10-14)31-3/h4-5,10-13H,6-9H2,1-3H3 |
| InChIKey | LYCUFKMALQREHL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline?
The IUPAC name of 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline (CID 44581758) is 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline.
What is the SMILES notation for 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline?
The canonical SMILES for 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline is COc1ccc(-c2cc(C(F)(F)F)cc3ncc(N4CCN(C)CC4)nc23)cc1OC.
What is the InChIKey of 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline?
The InChIKey is LYCUFKMALQREHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F3N4O2/c1-28-6-8-29(9-7-28)20-13-26-17-12-15(22(23,24)25)11-16(21(17)27-20)14-4-5-18(30-2)19(10-14)31-3/h4-5,10-13H,6-9H2,1-3H3.
What are the key properties of 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline?
8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline has a molecular weight of 432.45 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)quinoxaline is sourced from PubChem (CID 44581758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).