About 3-ethoxy-9H-indeno[2,1-c]pyridine
3-ethoxy-9H-indeno[2,1-c]pyridine (PubChem CID 44581820) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-ethoxy-9H-indeno[2,1-c]pyridine.
Molecular Properties
| Compound Name | 3-ethoxy-9H-indeno[2,1-c]pyridine |
| PubChem CID | 44581820 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-ethoxy-9H-indeno[2,1-c]pyridine |
| SMILES | CCOc1cc2c(cn1)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H13NO/c1-2-16-14-8-13-11(9-15-14)7-10-5-3-4-6-12(10)13/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | ZHSSZHZENZJSBW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-9H-indeno[2,1-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-9H-indeno[2,1-c]pyridine?
The IUPAC name of 3-ethoxy-9H-indeno[2,1-c]pyridine (CID 44581820) is 3-ethoxy-9H-indeno[2,1-c]pyridine.
What is the SMILES notation for 3-ethoxy-9H-indeno[2,1-c]pyridine?
The canonical SMILES for 3-ethoxy-9H-indeno[2,1-c]pyridine is CCOc1cc2c(cn1)Cc1ccccc1-2.
What is the InChIKey of 3-ethoxy-9H-indeno[2,1-c]pyridine?
The InChIKey is ZHSSZHZENZJSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO/c1-2-16-14-8-13-11(9-15-14)7-10-5-3-4-6-12(10)13/h3-6,8-9H,2,7H2,1H3.
What are the key properties of 3-ethoxy-9H-indeno[2,1-c]pyridine?
3-ethoxy-9H-indeno[2,1-c]pyridine has a molecular weight of 211.26 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-9H-indeno[2,1-c]pyridine is sourced from PubChem (CID 44581820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).