C21H28O9 — CID 44581872
dimethyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-2,7-dicarboxylate (PubChem CID 44581872) has the molecular formula C21H28O9 and a molecular weight of 424.45 g/mol. Its IUPAC name is dimethyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-2,7-dicarboxylate.
| Compound Name | dimethyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 44581872 |
| Molecular Formula | C21H28O9 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | dimethyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-2,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(C)[C@H]3C(=O)[C@@H](OC(C)=O)C[C@@H](C(=O)OC)[C@]3(C)CC[C@H]2C(=O)O1 |
| InChI | InChI=1S/C21H28O9/c1-10(22)29-13-8-12(17(24)27-4)20(2)7-6-11-18(25)30-14(19(26)28-5)9-21(11,3)16(20)15(13)23/h11-14,16H,6-9H2,1-5H3/t11-,12-,13-,14-,16-,20-,21-/m0/s1 |
| InChIKey | CNKJBJRRUBVYPB-XIUCMHNBSA-N |
| XLogP | 1.21 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|