C11H24N4O3 — CID 445819
(2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-hydroxyhexan-2-yl]propanamide (PubChem CID 445819) has the molecular formula C11H24N4O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-hydroxyhexan-2-yl]propanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-hydroxyhexan-2-yl]propanamide |
|---|---|
| PubChem CID | 445819 |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-hydroxyhexan-2-yl]propanamide |
| SMILES | C[C@@H](C(=O)N[C@@H](CCCCN)CO)NC(=O)CN |
| InChI | InChI=1S/C11H24N4O3/c1-8(14-10(17)6-13)11(18)15-9(7-16)4-2-3-5-12/h8-9,16H,2-7,12-13H2,1H3,(H,14,17)(H,15,18)/t8-,9-/m0/s1 |
| InChIKey | WJLWLNLETIIGJV-IUCAKERBSA-N |
| XLogP | -2.10 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | 261 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|