About 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine
2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine (PubChem CID 44582008) has the molecular formula C13H11FN2S2
and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine.
Molecular Properties
| Compound Name | 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine |
| PubChem CID | 44582008 |
| Molecular Formula | C13H11FN2S2 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine |
| SMILES | NS#Cc1cc(SCc2ccccc2F)ccn1 |
| InChI | InChI=1S/C13H11FN2S2/c14-13-4-2-1-3-10(13)8-17-12-5-6-16-11(7-12)9-18-15/h1-7H,8,15H2 |
| InChIKey | VRBWRPWWJNZWGX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine?
The IUPAC name of 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine (CID 44582008) is 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine.
What is the SMILES notation for 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine?
The canonical SMILES for 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine is NS#Cc1cc(SCc2ccccc2F)ccn1.
What is the InChIKey of 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine?
The InChIKey is VRBWRPWWJNZWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FN2S2/c14-13-4-2-1-3-10(13)8-17-12-5-6-16-11(7-12)9-18-15/h1-7H,8,15H2.
What are the key properties of 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine?
2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine has a molecular weight of 278.38 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(amino-λ4-sulfanylidyne)methyl]-4-[(2-fluorophenyl)methylsulfanyl]pyridine is sourced from PubChem (CID 44582008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).