C17H26N2O6 — CID 44582046
[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl octanoate (PubChem CID 44582046) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl octanoate.
| Compound Name | [(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 44582046 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@@H]1OC[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C17H26N2O6/c1-3-4-5-6-7-8-14(20)23-11-15-24-10-13(25-15)19-9-12(2)16(21)18-17(19)22/h9,13,15H,3-8,10-11H2,1-2H3,(H,18,21,22)/t13-,15-/m1/s1 |
| InChIKey | VGCZOPNRYSOTAW-UKRRQHHQSA-N |
| XLogP | 1.62 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|