C15H14OS2 — CID 44582166
(1E,4E)-1,5-bis(3-methylthiophen-2-yl)penta-1,4-dien-3-one (PubChem CID 44582166) has the molecular formula C15H14OS2 and a molecular weight of 274.41 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(3-methylthiophen-2-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(3-methylthiophen-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44582166 |
| Molecular Formula | C15H14OS2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (1E,4E)-1,5-bis(3-methylthiophen-2-yl)penta-1,4-dien-3-one |
| SMILES | Cc1ccsc1/C=C/C(=O)/C=C/c1sccc1C |
| InChI | InChI=1S/C15H14OS2/c1-11-7-9-17-14(11)5-3-13(16)4-6-15-12(2)8-10-18-15/h3-10H,1-2H3/b5-3+,6-4+ |
| InChIKey | ZLAIKOZCOMUVFE-GGWOSOGESA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|