C28H33N3O7 — CID 44582250
methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-(1-benzyltriazol-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 44582250) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-(1-benzyltriazol-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-(1-benzyltriazol-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 44582250 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-(1-benzyltriazol-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)C(=O)[C@H]2[C@@]1(C)CC[C@H]1C(=O)O[C@H](c3cn(Cc4ccccc4)nn3)C[C@]21C |
| InChI | InChI=1S/C28H33N3O7/c1-16(32)37-21-12-19(25(34)36-4)27(2)11-10-18-26(35)38-22(13-28(18,3)24(27)23(21)33)20-15-31(30-29-20)14-17-8-6-5-7-9-17/h5-9,15,18-19,21-22,24H,10-14H2,1-4H3/t18-,19-,21-,22-,24-,27-,28-/m0/s1 |
| InChIKey | SSOSWXKDSKJGOL-YZKBGIJPSA-N |
| XLogP | 3.05 |
| TPSA | 126.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|