C20H25N5O4 — CID 44582290
9-(oxan-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]purin-6-amine (PubChem CID 44582290) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 9-(oxan-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]purin-6-amine.
| Compound Name | 9-(oxan-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 44582290 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 9-(oxan-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]purin-6-amine |
| SMILES | COc1cc(OC)c(OC)cc1CNc1ncnc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C20H25N5O4/c1-26-14-9-16(28-3)15(27-2)8-13(14)10-21-19-18-20(23-11-22-19)25(12-24-18)17-6-4-5-7-29-17/h8-9,11-12,17H,4-7,10H2,1-3H3,(H,21,22,23) |
| InChIKey | UBAFXKHUHUVLHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |