C32H36O16 — CID 44582320
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-[6-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxynaphthalen-2-yl]oxyoxan-3-yl] acetate (PubChem CID 44582320) has the molecular formula C32H36O16 and a molecular weight of 676.62 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[6-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxynaphthalen-2-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[6-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxynaphthalen-2-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 44582320 |
| Molecular Formula | C32H36O16 |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[6-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxynaphthalen-2-yl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Oc2ccc3cc(O[C@@H]4OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)ccc3c2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H36O16/c1-15(33)41-25-13-39-31(29(45-19(5)37)27(25)43-17(3)35)47-23-9-7-22-12-24(10-8-21(22)11-23)48-32-30(46-20(6)38)28(44-18(4)36)26(14-40-32)42-16(2)34/h7-12,25-32H,13-14H2,1-6H3/t25-,26-,27+,28+,29-,30-,31+,32+/m1/s1 |
| InChIKey | ZWAQTRKNLOAPAV-SBHPHKOISA-N |
| XLogP | 1.90 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|